C15H28N4O — CID 50978431
(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(4-methylpiperidin-4-yl)methanone (PubChem CID 50978431) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(4-methylpiperidin-4-yl)methanone.
| Compound Name | (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(4-methylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 50978431 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(4-methylpiperidin-4-yl)methanone |
| SMILES | CN1CCN2CCN(C(=O)C3(C)CCNCC3)CC2C1 |
| InChI | InChI=1S/C15H28N4O/c1-15(3-5-16-6-4-15)14(20)19-10-9-18-8-7-17(2)11-13(18)12-19/h13,16H,3-12H2,1-2H3 |
| InChIKey | POSWOPHCYYOQIF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |