C13H24N4O — CID 50958892
8-methyl-2-piperidin-4-yl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one (PubChem CID 50958892) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 8-methyl-2-piperidin-4-yl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one.
| Compound Name | 8-methyl-2-piperidin-4-yl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 50958892 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 8-methyl-2-piperidin-4-yl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
| SMILES | CN1CCN2CCN(C3CCNCC3)CC2C1=O |
| InChI | InChI=1S/C13H24N4O/c1-15-6-7-16-8-9-17(10-12(16)13(15)18)11-2-4-14-5-3-11/h11-12,14H,2-10H2,1H3 |
| InChIKey | RGIOTORFQGOCHL-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |