C13H24FN5O — CID 123645954
2-(3-amino-5-fluoropiperidin-4-yl)-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one (PubChem CID 123645954) has the molecular formula C13H24FN5O and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-(3-amino-5-fluoropiperidin-4-yl)-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one.
| Compound Name | 2-(3-amino-5-fluoropiperidin-4-yl)-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 123645954 |
| Molecular Formula | C13H24FN5O |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 2-(3-amino-5-fluoropiperidin-4-yl)-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
| SMILES | CN1CCN2CCN(C3C(N)CNCC3F)CC2C1=O |
| InChI | InChI=1S/C13H24FN5O/c1-17-2-3-18-4-5-19(8-11(18)13(17)20)12-9(14)6-16-7-10(12)15/h9-12,16H,2-8,15H2,1H3 |
| InChIKey | IXESHURSVLKKAZ-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |