C13H23FN4O — CID 123557489
2-(3-amino-5-fluoropiperidin-4-yl)-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one (PubChem CID 123557489) has the molecular formula C13H23FN4O and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-(3-amino-5-fluoropiperidin-4-yl)-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one.
| Compound Name | 2-(3-amino-5-fluoropiperidin-4-yl)-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 123557489 |
| Molecular Formula | C13H23FN4O |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2-(3-amino-5-fluoropiperidin-4-yl)-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one |
| SMILES | NC1CNCC(F)C1N1CCN2C(=O)CCCC2C1 |
| InChI | InChI=1S/C13H23FN4O/c14-10-6-16-7-11(15)13(10)17-4-5-18-9(8-17)2-1-3-12(18)19/h9-11,13,16H,1-8,15H2 |
| InChIKey | XWDWBLSFAFMJCJ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |