C11H11ClN2OS2 — CID 5098079
N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]butanamide (PubChem CID 5098079) has the molecular formula C11H11ClN2OS2 and a molecular weight of 286.81 g/mol. Its IUPAC name is N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 5098079 |
| Molecular Formula | C11H11ClN2OS2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nc(-c2ccc(Cl)s2)cs1 |
| InChI | InChI=1S/C11H11ClN2OS2/c1-2-3-10(15)14-11-13-7(6-16-11)8-4-5-9(12)17-8/h4-6H,2-3H2,1H3,(H,13,14,15) |
| InChIKey | YKJDSCDAFUBVLW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |