C15H20N6O — CID 50981939
6-morpholin-4-yl-N-(1-pyrazin-2-ylpropan-2-yl)pyrimidin-4-amine (PubChem CID 50981939) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is 6-morpholin-4-yl-N-(1-pyrazin-2-ylpropan-2-yl)pyrimidin-4-amine.
| Compound Name | 6-morpholin-4-yl-N-(1-pyrazin-2-ylpropan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 50981939 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 6-morpholin-4-yl-N-(1-pyrazin-2-ylpropan-2-yl)pyrimidin-4-amine |
| SMILES | CC(Cc1cnccn1)Nc1cc(N2CCOCC2)ncn1 |
| InChI | InChI=1S/C15H20N6O/c1-12(8-13-10-16-2-3-17-13)20-14-9-15(19-11-18-14)21-4-6-22-7-5-21/h2-3,9-12H,4-8H2,1H3,(H,18,19,20) |
| InChIKey | WXTKEJPZPBMORC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |