C21H21N3O2 — CID 50983878
2-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]pyridine-3-carboxamide (PubChem CID 50983878) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 50983878 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1N1CC[C@@H](c2ccc3ccccc3c2)[C@H](O)C1 |
| InChI | InChI=1S/C21H21N3O2/c22-20(26)18-6-3-10-23-21(18)24-11-9-17(19(25)13-24)16-8-7-14-4-1-2-5-15(14)12-16/h1-8,10,12,17,19,25H,9,11,13H2,(H2,22,26)/t17-,19+/m0/s1 |
| InChIKey | NZBZXRGYIGVUCP-PKOBYXMFSA-N |
| XLogP | 2.69 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |