C21H25N3O2 — CID 50984302
N-(oxolan-2-ylmethyl)-2-(prop-2-enylamino)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 50984302) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-(prop-2-enylamino)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-(prop-2-enylamino)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 50984302 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-(prop-2-enylamino)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | C=CCNc1ccccc1C(=O)N(Cc1ccccn1)CC1CCCO1 |
| InChI | InChI=1S/C21H25N3O2/c1-2-12-23-20-11-4-3-10-19(20)21(25)24(16-18-9-7-14-26-18)15-17-8-5-6-13-22-17/h2-6,8,10-11,13,18,23H,1,7,9,12,14-16H2 |
| InChIKey | XKLMNYWOBHIDAY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|