C20H23F3N2O3 — CID 50985949
N-[2-(dimethylamino)phenyl]-2-phenylbutanamide;2,2,2-trifluoroacetic acid (PubChem CID 50985949) has the molecular formula C20H23F3N2O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is N-[2-(dimethylamino)phenyl]-2-phenylbutanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(dimethylamino)phenyl]-2-phenylbutanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 50985949 |
| Molecular Formula | C20H23F3N2O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[2-(dimethylamino)phenyl]-2-phenylbutanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCC(C(=O)Nc1ccccc1N(C)C)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N2O.C2HF3O2/c1-4-15(14-10-6-5-7-11-14)18(21)19-16-12-8-9-13-17(16)20(2)3;3-2(4,5)1(6)7/h5-13,15H,4H2,1-3H3,(H,19,21);(H,6,7) |
| InChIKey | KQKPCGIMOYYHEE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |