C17H28Cl2N2O — CID 50986772
2-(butylamino)-N-(2-chloro-6-methylphenyl)hexanamide;hydron;chloride (PubChem CID 50986772) has the molecular formula C17H28Cl2N2O and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-(butylamino)-N-(2-chloro-6-methylphenyl)hexanamide;hydron;chloride.
| Compound Name | 2-(butylamino)-N-(2-chloro-6-methylphenyl)hexanamide;hydron;chloride |
|---|---|
| PubChem CID | 50986772 |
| Molecular Formula | C17H28Cl2N2O |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-(butylamino)-N-(2-chloro-6-methylphenyl)hexanamide;hydron;chloride |
| SMILES | CCCCNC(CCCC)C(=O)Nc1c(C)cccc1Cl.[Cl-].[H+] |
| InChI | InChI=1S/C17H27ClN2O.ClH/c1-4-6-11-15(19-12-7-5-2)17(21)20-16-13(3)9-8-10-14(16)18;/h8-10,15,19H,4-7,11-12H2,1-3H3,(H,20,21);1H |
| InChIKey | NWCGVHWYNMIOCJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|