C9H13N3O — CID 50988019
4-ethoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 50988019) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-ethoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 4-ethoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 50988019 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 4-ethoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | CCOc1ncnc2c1CNCC2 |
| InChI | InChI=1S/C9H13N3O/c1-2-13-9-7-5-10-4-3-8(7)11-6-12-9/h6,10H,2-5H2,1H3 |
| InChIKey | VROMRJBUZCYJBV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |