About 4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 50989214) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
Analyze 4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The IUPAC name of 4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (CID 50989214) is 4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
What is the SMILES notation for 4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The canonical SMILES for 4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine is COc1ncnc2c1CNCC2.
What is the InChIKey of 4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The InChIKey is FAQYDZRQALQEDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-12-8-6-4-9-3-2-7(6)10-5-11-8/h5,9H,2-4H2,1H3.
What are the key properties of 4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine has a molecular weight of 165.20 g/mol, XLogP of 0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine is sourced from PubChem (CID 50989214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).