C23H27NO9 — CID 50990267
(1S,4aS,11S,11aR)-3-acetyl-1-(dimethylamino)-4,4a,5,7,11,12-hexahydroxy-11-methyl-1,5,5a,11a,12,12a-hexahydrotetracene-2,6-dione (PubChem CID 50990267) has the molecular formula C23H27NO9 and a molecular weight of 461.47 g/mol. Its IUPAC name is (1S,4aS,11S,11aR)-3-acetyl-1-(dimethylamino)-4,4a,5,7,11,12-hexahydroxy-11-methyl-1,5,5a,11a,12,12a-hexahydrotetracene-2,6-dione.
| Compound Name | (1S,4aS,11S,11aR)-3-acetyl-1-(dimethylamino)-4,4a,5,7,11,12-hexahydroxy-11-methyl-1,5,5a,11a,12,12a-hexahydrotetracene-2,6-dione |
|---|---|
| PubChem CID | 50990267 |
| Molecular Formula | C23H27NO9 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (1S,4aS,11S,11aR)-3-acetyl-1-(dimethylamino)-4,4a,5,7,11,12-hexahydroxy-11-methyl-1,5,5a,11a,12,12a-hexahydrotetracene-2,6-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(O)C3C(=O)c4c(O)cccc4[C@@](C)(O)[C@H]3C(O)C2C(N(C)C)C1=O |
| InChI | InChI=1S/C23H27NO9/c1-8(25)11-18(28)16(24(3)4)15-19(29)14-13(21(31)23(15,33)20(11)30)17(27)12-9(22(14,2)32)6-5-7-10(12)26/h5-7,13-16,19,21,26,29-33H,1-4H3/t13?,14-,15?,16?,19?,21?,22-,23-/m1/s1 |
| InChIKey | FDAKNNOIGRUPGJ-GOVBTDGCSA-N |
| XLogP | -0.97 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|