C28H27N5O3 — CID 50992239
(E)-3-[4-[[4-(1-benzoylbenzimidazol-2-yl)piperazin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 50992239) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is (E)-3-[4-[[4-(1-benzoylbenzimidazol-2-yl)piperazin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[4-(1-benzoylbenzimidazol-2-yl)piperazin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 50992239 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (E)-3-[4-[[4-(1-benzoylbenzimidazol-2-yl)piperazin-1-yl]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CN2CCN(c3nc4ccccc4n3C(=O)c3ccccc3)CC2)cc1)NO |
| InChI | InChI=1S/C28H27N5O3/c34-26(30-36)15-14-21-10-12-22(13-11-21)20-31-16-18-32(19-17-31)28-29-24-8-4-5-9-25(24)33(28)27(35)23-6-2-1-3-7-23/h1-15,36H,16-20H2,(H,30,34)/b15-14+ |
| InChIKey | GBKOLLUFXWWPHQ-CCEZHUSRSA-N |
| XLogP | 3.57 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|