About S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate
S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate (PubChem CID 50992918) has the molecular formula C21H23NO3S
and a molecular weight of 369.49 g/mol. Its IUPAC name is S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate.
Molecular Properties
| Compound Name | S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate |
| PubChem CID | 50992918 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate |
| SMILES | CC(C)(C)SC(=O)C[C@]1(O)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H23NO3S/c1-20(2,3)26-18(23)13-21(25)16-11-7-8-12-17(16)22(19(21)24)14-15-9-5-4-6-10-15/h4-12,25H,13-14H2,1-3H3/t21-/m1/s1 |
| InChIKey | PTPGBXXPMNPGID-OAQYLSRUSA-N |
| XLogP | 3.87 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate?
The IUPAC name of S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate (CID 50992918) is S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate.
What is the SMILES notation for S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate?
The canonical SMILES for S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate is CC(C)(C)SC(=O)C[C@]1(O)C(=O)N(Cc2ccccc2)c2ccccc21.
What is the InChIKey of S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate?
The InChIKey is PTPGBXXPMNPGID-OAQYLSRUSA-N. The full InChI is InChI=1S/C21H23NO3S/c1-20(2,3)26-18(23)13-21(25)16-11-7-8-12-17(16)22(19(21)24)14-15-9-5-4-6-10-15/h4-12,25H,13-14H2,1-3H3/t21-/m1/s1.
What are the key properties of S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate?
S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate has a molecular weight of 369.49 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butyl 2-[(3R)-1-benzyl-3-hydroxy-2-oxoindol-3-yl]ethanethioate is sourced from PubChem (CID 50992918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).