C25H35FN4O4 — CID 5099363
2-[butylcarbamoyl(2-morpholin-4-ylethyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 5099363) has the molecular formula C25H35FN4O4 and a molecular weight of 474.58 g/mol. Its IUPAC name is 2-[butylcarbamoyl(2-morpholin-4-ylethyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[butylcarbamoyl(2-morpholin-4-ylethyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 5099363 |
| Molecular Formula | C25H35FN4O4 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 2-[butylcarbamoyl(2-morpholin-4-ylethyl)amino]-N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCCCNC(=O)N(CCN1CCOCC1)CC(=O)N(Cc1ccc(F)cc1)Cc1ccco1 |
| InChI | InChI=1S/C25H35FN4O4/c1-2-3-10-27-25(32)29(12-11-28-13-16-33-17-14-28)20-24(31)30(19-23-5-4-15-34-23)18-21-6-8-22(26)9-7-21/h4-9,15H,2-3,10-14,16-20H2,1H3,(H,27,32) |
| InChIKey | DOOXCSDIAVSNRZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|