C25H30N2O2 — CID 50994131
N,N-dibutyl-2-(1-methyl-2-phenylindol-3-yl)-2-oxoacetamide (PubChem CID 50994131) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N,N-dibutyl-2-(1-methyl-2-phenylindol-3-yl)-2-oxoacetamide.
| Compound Name | N,N-dibutyl-2-(1-methyl-2-phenylindol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 50994131 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N,N-dibutyl-2-(1-methyl-2-phenylindol-3-yl)-2-oxoacetamide |
| SMILES | CCCCN(CCCC)C(=O)C(=O)c1c(-c2ccccc2)n(C)c2ccccc12 |
| InChI | InChI=1S/C25H30N2O2/c1-4-6-17-27(18-7-5-2)25(29)24(28)22-20-15-11-12-16-21(20)26(3)23(22)19-13-9-8-10-14-19/h8-16H,4-7,17-18H2,1-3H3 |
| InChIKey | OXEHPUVTSXWYIV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|