C31H29BrCl2N2O5 — CID 5099535
8-(bromomethyl)-6a,9a-dichloro-2-cyclohexyl-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5099535) has the molecular formula C31H29BrCl2N2O5 and a molecular weight of 660.39 g/mol. Its IUPAC name is 8-(bromomethyl)-6a,9a-dichloro-2-cyclohexyl-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(bromomethyl)-6a,9a-dichloro-2-cyclohexyl-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5099535 |
| Molecular Formula | C31H29BrCl2N2O5 |
| Molecular Weight | 660.39 g/mol |
| Exact Mass | 658.06 |
| IUPAC Name | 8-(bromomethyl)-6a,9a-dichloro-2-cyclohexyl-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(CBr)C(=O)C4(Cl)C3c3ccc(O)c4ccccc34)C2C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C31H29BrCl2N2O5/c32-15-35-28(40)30(33)14-22-20(10-11-21-24(22)27(39)36(26(21)38)16-6-2-1-3-7-16)25(31(30,34)29(35)41)19-12-13-23(37)18-9-5-4-8-17(18)19/h4-5,8-10,12-13,16,21-22,24-25,37H,1-3,6-7,11,14-15H2 |
| InChIKey | HKNCGIRKTLXBNC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|