C28H22F3N7O — CID 50995578
3-[[4-(2,4,5,6-tetradeuterio-3-pyridinyl)pyrimidin-2-yl]amino]-4-(trideuteriomethyl)-N-[2,4,6-trideuterio-3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 50995578) has the molecular formula C28H22F3N7O and a molecular weight of 539.59 g/mol. Its IUPAC name is 3-[[4-(2,4,5,6-tetradeuterio-3-pyridinyl)pyrimidin-2-yl]amino]-4-(trideuteriomethyl)-N-[2,4,6-trideuterio-3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[[4-(2,4,5,6-tetradeuterio-3-pyridinyl)pyrimidin-2-yl]amino]-4-(trideuteriomethyl)-N-[2,4,6-trideuterio-3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 50995578 |
| Molecular Formula | C28H22F3N7O |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 3-[[4-(2,4,5,6-tetradeuterio-3-pyridinyl)pyrimidin-2-yl]amino]-4-(trideuteriomethyl)-N-[2,4,6-trideuterio-3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | [2H]c1nc([2H])c(-c2ccnc(Nc3cc(C(=O)Nc4c([2H])c(-n5cnc(C)c5)c([2H])c(C(F)(F)F)c4[2H])ccc3C([2H])([2H])[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C28H22F3N7O/c1-17-5-6-19(10-25(17)37-27-33-9-7-24(36-27)20-4-3-8-32-14-20)26(39)35-22-11-21(28(29,30)31)12-23(13-22)38-15-18(2)34-16-38/h3-16H,1-2H3,(H,35,39)(H,33,36,37)/i1D3,3D,4D,8D,11D,12D,13D,14D |
| InChIKey | HHZIURLSWUIHRB-RVOHHDSBSA-N |
| XLogP | 6.36 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |