C28H22F3N7O — CID 50997546
2,3,6-trideuterio-4-methyl-5-[(4-pyridin-3-ylpyrimidin-2-yl)amino]-N-[2,4,6-trideuterio-3-[4-(trideuteriomethyl)imidazol-1-yl]-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 50997546) has the molecular formula C28H22F3N7O and a molecular weight of 538.58 g/mol. Its IUPAC name is 2,3,6-trideuterio-4-methyl-5-[(4-pyridin-3-ylpyrimidin-2-yl)amino]-N-[2,4,6-trideuterio-3-[4-(trideuteriomethyl)imidazol-1-yl]-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2,3,6-trideuterio-4-methyl-5-[(4-pyridin-3-ylpyrimidin-2-yl)amino]-N-[2,4,6-trideuterio-3-[4-(trideuteriomethyl)imidazol-1-yl]-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 50997546 |
| Molecular Formula | C28H22F3N7O |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 2,3,6-trideuterio-4-methyl-5-[(4-pyridin-3-ylpyrimidin-2-yl)amino]-N-[2,4,6-trideuterio-3-[4-(trideuteriomethyl)imidazol-1-yl]-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | [2H]c1c([2H])c(C(=O)Nc2c([2H])c(-n3cnc(C([2H])([2H])[2H])c3)c([2H])c(C(F)(F)F)c2[2H])c([2H])c(Nc2nccc(-c3cccnc3)n2)c1C |
| InChI | InChI=1S/C28H22F3N7O/c1-17-5-6-19(10-25(17)37-27-33-9-7-24(36-27)20-4-3-8-32-14-20)26(39)35-22-11-21(28(29,30)31)12-23(13-22)38-15-18(2)34-16-38/h3-16H,1-2H3,(H,35,39)(H,33,36,37)/i2D3,5D,6D,10D,11D,12D,13D |
| InChIKey | HHZIURLSWUIHRB-HHSYTNABSA-N |
| XLogP | 6.36 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |