C28H26Cl2N4O2 — CID 50996418
1,5-bis(3-chlorophenyl)-N-(2-morpholin-4-ylethyl)-2-phenylimidazole-4-carboxamide (PubChem CID 50996418) has the molecular formula C28H26Cl2N4O2 and a molecular weight of 521.45 g/mol. Its IUPAC name is 1,5-bis(3-chlorophenyl)-N-(2-morpholin-4-ylethyl)-2-phenylimidazole-4-carboxamide.
| Compound Name | 1,5-bis(3-chlorophenyl)-N-(2-morpholin-4-ylethyl)-2-phenylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 50996418 |
| Molecular Formula | C28H26Cl2N4O2 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 1,5-bis(3-chlorophenyl)-N-(2-morpholin-4-ylethyl)-2-phenylimidazole-4-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1nc(-c2ccccc2)n(-c2cccc(Cl)c2)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H26Cl2N4O2/c29-22-9-4-8-21(18-22)26-25(28(35)31-12-13-33-14-16-36-17-15-33)32-27(20-6-2-1-3-7-20)34(26)24-11-5-10-23(30)19-24/h1-11,18-19H,12-17H2,(H,31,35) |
| InChIKey | HZKJGUYPPGGGEC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |