C20H15F3N6O — CID 51000563
N-[2-[6-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]ethyl]pteridin-4-amine (PubChem CID 51000563) has the molecular formula C20H15F3N6O and a molecular weight of 412.38 g/mol. Its IUPAC name is N-[2-[6-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]ethyl]pteridin-4-amine.
| Compound Name | N-[2-[6-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]ethyl]pteridin-4-amine |
|---|---|
| PubChem CID | 51000563 |
| Molecular Formula | C20H15F3N6O |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[2-[6-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]ethyl]pteridin-4-amine |
| SMILES | FC(F)(F)c1ccc(Oc2ccc(CCNc3ncnc4nccnc34)cn2)cc1 |
| InChI | InChI=1S/C20H15F3N6O/c21-20(22,23)14-2-4-15(5-3-14)30-16-6-1-13(11-27-16)7-8-25-18-17-19(29-12-28-18)26-10-9-24-17/h1-6,9-12H,7-8H2,(H,25,26,28,29) |
| InChIKey | NBTGKZJCOGHAAW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |