C15H15N5O — CID 5328088
4-N-[(3-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 5328088) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-N-[(3-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-[(3-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328088 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-N-[(3-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | COc1cccc(CNc2ncnc3cc(N)ncc23)c1 |
| InChI | InChI=1S/C15H15N5O/c1-21-11-4-2-3-10(5-11)7-18-15-12-8-17-14(16)6-13(12)19-9-20-15/h2-6,8-9H,7H2,1H3,(H2,16,17)(H,18,19,20) |
| InChIKey | OWBQYDARFOLTFW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |