C29H42N6O3 — CID 5330133
1-tert-butyl-3-[7-[4-(diethylamino)butylamino]-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]urea (PubChem CID 5330133) has the molecular formula C29H42N6O3 and a molecular weight of 522.69 g/mol. Its IUPAC name is 1-tert-butyl-3-[7-[4-(diethylamino)butylamino]-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[7-[4-(diethylamino)butylamino]-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 5330133 |
| Molecular Formula | C29H42N6O3 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 1-tert-butyl-3-[7-[4-(diethylamino)butylamino]-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-yl]urea |
| SMILES | CCN(CC)CCCCNc1cc2nc(NC(=O)NC(C)(C)C)c(-c3cc(OC)cc(OC)c3)cc2cn1 |
| InChI | InChI=1S/C29H42N6O3/c1-8-35(9-2)13-11-10-12-30-26-18-25-21(19-31-26)16-24(20-14-22(37-6)17-23(15-20)38-7)27(32-25)33-28(36)34-29(3,4)5/h14-19H,8-13H2,1-7H3,(H,30,31)(H2,32,33,34,36) |
| InChIKey | YMKCMNJQFGEWCA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|