C20H12F6N6O — CID 51000641
N-[2-[4-[[3,5,6-trifluoro-4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]pteridin-4-amine (PubChem CID 51000641) has the molecular formula C20H12F6N6O and a molecular weight of 466.35 g/mol. Its IUPAC name is N-[2-[4-[[3,5,6-trifluoro-4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]pteridin-4-amine.
| Compound Name | N-[2-[4-[[3,5,6-trifluoro-4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]pteridin-4-amine |
|---|---|
| PubChem CID | 51000641 |
| Molecular Formula | C20H12F6N6O |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-[2-[4-[[3,5,6-trifluoro-4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]pteridin-4-amine |
| SMILES | Fc1nc(Oc2ccc(CCNc3ncnc4nccnc34)cc2)c(F)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C20H12F6N6O/c21-13-12(20(24,25)26)14(22)19(32-16(13)23)33-11-3-1-10(2-4-11)5-6-28-17-15-18(31-9-30-17)29-8-7-27-15/h1-4,7-9H,5-6H2,(H,28,29,30,31) |
| InChIKey | WQGNVXRAMWZMAV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|