C31H45N5O10 — CID 51000807
[2-(decanoylamino)-3-hydroxy-3-phenylpropyl] N-[2-[[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-2-oxoethyl]carbamate (PubChem CID 51000807) has the molecular formula C31H45N5O10 and a molecular weight of 647.73 g/mol. Its IUPAC name is [2-(decanoylamino)-3-hydroxy-3-phenylpropyl] N-[2-[[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-2-oxoethyl]carbamate.
| Compound Name | [2-(decanoylamino)-3-hydroxy-3-phenylpropyl] N-[2-[[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 51000807 |
| Molecular Formula | C31H45N5O10 |
| Molecular Weight | 647.73 g/mol |
| Exact Mass | 647.32 |
| IUPAC Name | [2-(decanoylamino)-3-hydroxy-3-phenylpropyl] N-[2-[[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCCCCCC(=O)NC(COC(=O)NCC(=O)NC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C(O)C1O)C(O)c1ccccc1 |
| InChI | InChI=1S/C31H45N5O10/c1-2-3-4-5-6-7-11-14-23(37)34-21(26(40)20-12-9-8-10-13-20)19-45-31(44)33-18-25(39)32-17-22-27(41)28(42)29(46-22)36-16-15-24(38)35-30(36)43/h8-10,12-13,15-16,21-22,26-29,40-42H,2-7,11,14,17-19H2,1H3,(H,32,39)(H,33,44)(H,34,37)(H,35,38,43)/t21?,22-,26?,27?,28?,29-/m1/s1 |
| InChIKey | BGHIQDBPGOFVES-WRFGJPBVSA-N |
| XLogP | 0.36 |
| TPSA | 221.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.73 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|