C29H34N4O7 — CID 51361644
(2R)-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-3-phenyl-N-(2-phenylpropyl)propanamide (PubChem CID 51361644) has the molecular formula C29H34N4O7 and a molecular weight of 550.61 g/mol. Its IUPAC name is (2R)-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-3-phenyl-N-(2-phenylpropyl)propanamide.
| Compound Name | (2R)-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-3-phenyl-N-(2-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 51361644 |
| Molecular Formula | C29H34N4O7 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | (2R)-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-3-phenyl-N-(2-phenylpropyl)propanamide |
| SMILES | CC(CNC(=O)[C@@H](Cc1ccccc1)NC(=O)CC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C29H34N4O7/c1-18(20-10-6-3-7-11-20)17-30-27(38)21(16-19-8-4-2-5-9-19)31-23(34)13-12-22-25(36)26(37)28(40-22)33-15-14-24(35)32-29(33)39/h2-11,14-15,18,21-22,25-26,28,36-37H,12-13,16-17H2,1H3,(H,30,38)(H,31,34)(H,32,35,39)/t18?,21-,22-,25-,26-,28-/m1/s1 |
| InChIKey | NCCAOVPQOKBCFG-YQWCDDKNSA-N |
| XLogP | 0.58 |
| TPSA | 162.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |