C24H32N4O8 — CID 51361641
(2R)-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-N-(3-methoxypropyl)-3-phenylpropanamide (PubChem CID 51361641) has the molecular formula C24H32N4O8 and a molecular weight of 504.54 g/mol. Its IUPAC name is (2R)-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-N-(3-methoxypropyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-N-(3-methoxypropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 51361641 |
| Molecular Formula | C24H32N4O8 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | (2R)-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-N-(3-methoxypropyl)-3-phenylpropanamide |
| SMILES | COCCCNC(=O)[C@@H](Cc1ccccc1)NC(=O)CC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H32N4O8/c1-35-13-5-11-25-22(33)16(14-15-6-3-2-4-7-15)26-18(29)9-8-17-20(31)21(32)23(36-17)28-12-10-19(30)27-24(28)34/h2-4,6-7,10,12,16-17,20-21,23,31-32H,5,8-9,11,13-14H2,1H3,(H,25,33)(H,26,29)(H,27,30,34)/t16-,17-,20-,21-,23-/m1/s1 |
| InChIKey | MXOJPMDDTVERCP-KKLOIMHHSA-N |
| XLogP | -1.18 |
| TPSA | 171.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|