About [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate
[7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate (PubChem CID 51001876) has the molecular formula C16H22ClN3O2S
and a molecular weight of 355.89 g/mol. Its IUPAC name is [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate.
Molecular Properties
| Compound Name | [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate |
| PubChem CID | 51001876 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate |
| SMILES | CN(C)c1ccc2nc3ccc(=[N+](C)C)cc-3sc2c1.O.O.[Cl-] |
| InChI | InChI=1S/C16H18N3S.ClH.2H2O/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;;;/h5-10H,1-4H3;1H;2*1H2/q+1;;;/p-1 |
| InChIKey | ULEZOVPNGWYYGH-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate?
The IUPAC name of [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate (CID 51001876) is [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate.
What is the SMILES notation for [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate?
The canonical SMILES for [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate is CN(C)c1ccc2nc3ccc(=[N+](C)C)cc-3sc2c1.O.O.[Cl-].
What is the InChIKey of [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate?
The InChIKey is ULEZOVPNGWYYGH-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H18N3S.ClH.2H2O/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;;;/h5-10H,1-4H3;1H;2*1H2/q+1;;;/p-1.
What are the key properties of [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate?
[7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate has a molecular weight of 355.89 g/mol, XLogP of -2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;dihydrate is sourced from PubChem (CID 51001876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).