C15H22Br2O3 — CID 51002891
(5R)-5-[(1E,3R)-10,10-dibromo-3-methoxydeca-1,9-dienyl]oxolan-2-one (PubChem CID 51002891) has the molecular formula C15H22Br2O3 and a molecular weight of 410.15 g/mol. Its IUPAC name is (5R)-5-[(1E,3R)-10,10-dibromo-3-methoxydeca-1,9-dienyl]oxolan-2-one.
| Compound Name | (5R)-5-[(1E,3R)-10,10-dibromo-3-methoxydeca-1,9-dienyl]oxolan-2-one |
|---|---|
| PubChem CID | 51002891 |
| Molecular Formula | C15H22Br2O3 |
| Molecular Weight | 410.15 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | (5R)-5-[(1E,3R)-10,10-dibromo-3-methoxydeca-1,9-dienyl]oxolan-2-one |
| SMILES | CO[C@@H](/C=C/[C@H]1CCC(=O)O1)CCCCCC=C(Br)Br |
| InChI | InChI=1S/C15H22Br2O3/c1-19-12(6-4-2-3-5-7-14(16)17)8-9-13-10-11-15(18)20-13/h7-9,12-13H,2-6,10-11H2,1H3/b9-8+/t12-,13+/m1/s1 |
| InChIKey | VKOGIGKSQGLZNY-VSONXHSHSA-N |
| XLogP | 4.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.15 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|