C14H20Br2O3 — CID 51002844
(5S)-5-[(1E,3R)-10,10-dibromo-3-hydroxydeca-1,9-dienyl]oxolan-2-one (PubChem CID 51002844) has the molecular formula C14H20Br2O3 and a molecular weight of 396.12 g/mol. Its IUPAC name is (5S)-5-[(1E,3R)-10,10-dibromo-3-hydroxydeca-1,9-dienyl]oxolan-2-one.
| Compound Name | (5S)-5-[(1E,3R)-10,10-dibromo-3-hydroxydeca-1,9-dienyl]oxolan-2-one |
|---|---|
| PubChem CID | 51002844 |
| Molecular Formula | C14H20Br2O3 |
| Molecular Weight | 396.12 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | (5S)-5-[(1E,3R)-10,10-dibromo-3-hydroxydeca-1,9-dienyl]oxolan-2-one |
| SMILES | O=C1CC[C@@H](/C=C/[C@H](O)CCCCCC=C(Br)Br)O1 |
| InChI | InChI=1S/C14H20Br2O3/c15-13(16)6-4-2-1-3-5-11(17)7-8-12-9-10-14(18)19-12/h6-8,11-12,17H,1-5,9-10H2/b8-7+/t11-,12-/m1/s1 |
| InChIKey | MZAQGPQBEPVOJJ-IDDPWSFUSA-N |
| XLogP | 4.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.12 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|