C16H26Br2O4 — CID 51002947
methyl (5E,7S)-14,14-dibromo-7-hydroxy-4-methoxytetradeca-5,13-dienoate (PubChem CID 51002947) has the molecular formula C16H26Br2O4 and a molecular weight of 442.19 g/mol. Its IUPAC name is methyl (5E,7S)-14,14-dibromo-7-hydroxy-4-methoxytetradeca-5,13-dienoate.
| Compound Name | methyl (5E,7S)-14,14-dibromo-7-hydroxy-4-methoxytetradeca-5,13-dienoate |
|---|---|
| PubChem CID | 51002947 |
| Molecular Formula | C16H26Br2O4 |
| Molecular Weight | 442.19 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | methyl (5E,7S)-14,14-dibromo-7-hydroxy-4-methoxytetradeca-5,13-dienoate |
| SMILES | COC(=O)CCC(/C=C/[C@@H](O)CCCCCC=C(Br)Br)OC |
| InChI | InChI=1S/C16H26Br2O4/c1-21-14(11-12-16(20)22-2)10-9-13(19)7-5-3-4-6-8-15(17)18/h8-10,13-14,19H,3-7,11-12H2,1-2H3/b10-9+/t13-,14?/m0/s1 |
| InChIKey | IPOHXAFISLFILY-IYLVLJOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.19 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|