C15H24Br2O4 — CID 51002802
methyl (4Z,6R,7S)-14,14-dibromo-6,7-dihydroxytetradeca-4,13-dienoate (PubChem CID 51002802) has the molecular formula C15H24Br2O4 and a molecular weight of 428.16 g/mol. Its IUPAC name is methyl (4Z,6R,7S)-14,14-dibromo-6,7-dihydroxytetradeca-4,13-dienoate.
| Compound Name | methyl (4Z,6R,7S)-14,14-dibromo-6,7-dihydroxytetradeca-4,13-dienoate |
|---|---|
| PubChem CID | 51002802 |
| Molecular Formula | C15H24Br2O4 |
| Molecular Weight | 428.16 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | methyl (4Z,6R,7S)-14,14-dibromo-6,7-dihydroxytetradeca-4,13-dienoate |
| SMILES | COC(=O)CC/C=C\[C@@H](O)[C@@H](O)CCCCCC=C(Br)Br |
| InChI | InChI=1S/C15H24Br2O4/c1-21-15(20)11-7-6-9-13(19)12(18)8-4-2-3-5-10-14(16)17/h6,9-10,12-13,18-19H,2-5,7-8,11H2,1H3/b9-6-/t12-,13+/m0/s1 |
| InChIKey | FFPKKWNJQCYPHB-QDIXBRCLSA-N |
| XLogP | 3.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|