C31H49NO2 — CID 51013805
methyl (9R)-4-(2-cyanoethyl)-4,9,10-trimethyl-15-propan-2-yl-3-prop-1-en-2-yl-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylate (PubChem CID 51013805) has the molecular formula C31H49NO2 and a molecular weight of 467.74 g/mol. Its IUPAC name is methyl (9R)-4-(2-cyanoethyl)-4,9,10-trimethyl-15-propan-2-yl-3-prop-1-en-2-yl-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylate.
| Compound Name | methyl (9R)-4-(2-cyanoethyl)-4,9,10-trimethyl-15-propan-2-yl-3-prop-1-en-2-yl-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylate |
|---|---|
| PubChem CID | 51013805 |
| Molecular Formula | C31H49NO2 |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 467.38 |
| IUPAC Name | methyl (9R)-4-(2-cyanoethyl)-4,9,10-trimethyl-15-propan-2-yl-3-prop-1-en-2-yl-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylate |
| SMILES | C=C(C)C1CCC2(C)C(CCC3C4C(C(C)C)CCC4(C(=O)OC)CC[C@]32C)C1(C)CCC#N |
| InChI | InChI=1S/C31H49NO2/c1-20(2)22-12-16-31(27(33)34-8)18-17-29(6)24(26(22)31)10-11-25-28(5,14-9-19-32)23(21(3)4)13-15-30(25,29)7/h20,22-26H,3,9-18H2,1-2,4-8H3/t22?,23?,24?,25?,26?,28?,29-,30?,31?/m1/s1 |
| InChIKey | SSMJLECJBRBDME-GGUAGXABSA-N |
| XLogP | 7.96 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|