C25H23Br2NO5 — CID 5102443
[2-(3,4-dimethylphenyl)-2-oxoethyl] 4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate (PubChem CID 5102443) has the molecular formula C25H23Br2NO5 and a molecular weight of 577.27 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] 4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate.
| Compound Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 5102443 |
| Molecular Formula | C25H23Br2NO5 |
| Molecular Weight | 577.27 g/mol |
| Exact Mass | 574.99 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)C4CC(Br)C(Br)CC4C3=O)cc2)cc1C |
| InChI | InChI=1S/C25H23Br2NO5/c1-13-3-4-16(9-14(13)2)22(29)12-33-25(32)15-5-7-17(8-6-15)28-23(30)18-10-20(26)21(27)11-19(18)24(28)31/h3-9,18-21H,10-12H2,1-2H3 |
| InChIKey | RWNKZXIVQDDFMT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|