C37H35ClN2O6 — CID 5102509
8-(3-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a-phenyl-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5102509) has the molecular formula C37H35ClN2O6 and a molecular weight of 639.15 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a-phenyl-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a-phenyl-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5102509 |
| Molecular Formula | C37H35ClN2O6 |
| Molecular Weight | 639.15 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | 8-(3-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a-phenyl-2-propyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCCN1C(=O)C2CC=C3C(CC4C(=O)N(c5cccc(Cl)c5)C(=O)C4(c4ccccc4)C3c3cccc(OCC)c3O)C2C1=O |
| InChI | InChI=1S/C37H35ClN2O6/c1-3-18-39-33(42)25-17-16-24-27(30(25)35(39)44)20-28-34(43)40(23-13-8-12-22(38)19-23)36(45)37(28,21-10-6-5-7-11-21)31(24)26-14-9-15-29(32(26)41)46-4-2/h5-16,19,25,27-28,30-31,41H,3-4,17-18,20H2,1-2H3 |
| InChIKey | VGWHDHQYEDLKGI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.15 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|