C12H10N2O2 — CID 5102564
naphthalene-2,3-dicarboxamide (PubChem CID 5102564) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is naphthalene-2,3-dicarboxamide.
| Compound Name | naphthalene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 5102564 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | naphthalene-2,3-dicarboxamide |
| SMILES | NC(=O)c1cc2ccccc2cc1C(N)=O |
| InChI | InChI=1S/C12H10N2O2/c13-11(15)9-5-7-3-1-2-4-8(7)6-10(9)12(14)16/h1-6H,(H2,13,15)(H2,14,16) |
| InChIKey | OABIEOPOGPOCJL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |