C6H9BrO2 — CID 51029462
(1R,4R,5S)-4-bromo-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 51029462) has the molecular formula C6H9BrO2 and a molecular weight of 193.04 g/mol. Its IUPAC name is (1R,4R,5S)-4-bromo-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1R,4R,5S)-4-bromo-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 51029462 |
| Molecular Formula | C6H9BrO2 |
| Molecular Weight | 193.04 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | (1R,4R,5S)-4-bromo-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | Br[C@@H]1CC[C@@H]2CO[C@H]1O2 |
| InChI | InChI=1S/C6H9BrO2/c7-5-2-1-4-3-8-6(5)9-4/h4-6H,1-3H2/t4-,5-,6+/m1/s1 |
| InChIKey | MAIUQAOEFRYBOB-PBXRRBTRSA-N |
| XLogP | 1.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.04 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|