C8H16O2 — CID 156638289
6,8-dioxabicyclo[3.2.1]octane;ethane (PubChem CID 156638289) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is 6,8-dioxabicyclo[3.2.1]octane;ethane.
| Compound Name | 6,8-dioxabicyclo[3.2.1]octane;ethane |
|---|---|
| PubChem CID | 156638289 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 6,8-dioxabicyclo[3.2.1]octane;ethane |
| SMILES | C1CC2COC(C1)O2.CC |
| InChI | InChI=1S/C6H10O2.C2H6/c1-2-5-4-7-6(3-1)8-5;1-2/h5-6H,1-4H2;1-2H3 |
| InChIKey | IMIIDCUWAZUJDV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |