C5H10ClNO2 — CID 57424736
6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride (PubChem CID 57424736) has the molecular formula C5H10ClNO2 and a molecular weight of 151.59 g/mol. Its IUPAC name is 6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride.
| Compound Name | 6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride |
|---|---|
| PubChem CID | 57424736 |
| Molecular Formula | C5H10ClNO2 |
| Molecular Weight | 151.59 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride |
| SMILES | C1NCC2OCC1O2.Cl |
| InChI | InChI=1S/C5H9NO2.ClH/c1-4-3-7-5(8-4)2-6-1;/h4-6H,1-3H2;1H |
| InChIKey | LAHFNMZSKOCQLB-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.59 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |