C7H16Cl2N2O — CID 57426967
2-oxa-5,8-diazabicyclo[4.3.1]decane;dihydrochloride (PubChem CID 57426967) has the molecular formula C7H16Cl2N2O and a molecular weight of 215.12 g/mol. Its IUPAC name is 2-oxa-5,8-diazabicyclo[4.3.1]decane;dihydrochloride.
| Compound Name | 2-oxa-5,8-diazabicyclo[4.3.1]decane;dihydrochloride |
|---|---|
| PubChem CID | 57426967 |
| Molecular Formula | C7H16Cl2N2O |
| Molecular Weight | 215.12 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-oxa-5,8-diazabicyclo[4.3.1]decane;dihydrochloride |
| SMILES | C1COC2CNCC(C2)N1.Cl.Cl |
| InChI | InChI=1S/C7H14N2O.2ClH/c1-2-10-7-3-6(9-1)4-8-5-7;;/h6-9H,1-5H2;2*1H |
| InChIKey | LHBYUOOOJXNWES-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.12 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |