C7H15N3 — CID 118210198
2,5,8-triazabicyclo[5.2.1]decane (PubChem CID 118210198) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is 2,5,8-triazabicyclo[5.2.1]decane.
| Compound Name | 2,5,8-triazabicyclo[5.2.1]decane |
|---|---|
| PubChem CID | 118210198 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 2,5,8-triazabicyclo[5.2.1]decane |
| SMILES | C1CNC2CNC(CN1)C2 |
| InChI | InChI=1S/C7H15N3/c1-2-9-7-3-6(4-8-1)10-5-7/h6-10H,1-5H2 |
| InChIKey | ARIGJNGSHGWKDB-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |