C12H27N7 — CID 174866401
N,N-di(piperazin-2-yl)piperazin-2-amine (PubChem CID 174866401) has the molecular formula C12H27N7 and a molecular weight of 269.40 g/mol. Its IUPAC name is N,N-di(piperazin-2-yl)piperazin-2-amine.
| Compound Name | N,N-di(piperazin-2-yl)piperazin-2-amine |
|---|---|
| PubChem CID | 174866401 |
| Molecular Formula | C12H27N7 |
| Molecular Weight | 269.40 g/mol |
| Exact Mass | 269.23 |
| IUPAC Name | N,N-di(piperazin-2-yl)piperazin-2-amine |
| SMILES | C1CNC(N(C2CNCCN2)C2CNCCN2)CN1 |
| InChI | InChI=1S/C12H27N7/c1-4-16-10(7-13-1)19(11-8-14-2-5-17-11)12-9-15-3-6-18-12/h10-18H,1-9H2 |
| InChIKey | XHCYFLKJNDTPMV-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.40 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |