C4H6O3 — CID 146477270
2,5,7-trioxabicyclo[2.2.1]heptane (PubChem CID 146477270) has the molecular formula C4H6O3 and a molecular weight of 102.09 g/mol. Its IUPAC name is 2,5,7-trioxabicyclo[2.2.1]heptane.
| Compound Name | 2,5,7-trioxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 146477270 |
| Molecular Formula | C4H6O3 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.03 |
| IUPAC Name | 2,5,7-trioxabicyclo[2.2.1]heptane |
| SMILES | C1OC2COC1O2 |
| InChI | InChI=1S/C4H6O3/c1-3-6-2-4(5-1)7-3/h3-4H,1-2H2 |
| InChIKey | ZCWULCRRSJYHKJ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |