C5H8O3 — CID 91588647
(1S,4S,5S)-2,7-dioxabicyclo[2.2.1]heptan-5-ol (PubChem CID 91588647) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is (1S,4S,5S)-2,7-dioxabicyclo[2.2.1]heptan-5-ol.
| Compound Name | (1S,4S,5S)-2,7-dioxabicyclo[2.2.1]heptan-5-ol |
|---|---|
| PubChem CID | 91588647 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (1S,4S,5S)-2,7-dioxabicyclo[2.2.1]heptan-5-ol |
| SMILES | O[C@H]1C[C@H]2OC[C@@H]1O2 |
| InChI | InChI=1S/C5H8O3/c6-3-1-5-7-2-4(3)8-5/h3-6H,1-2H2/t3-,4-,5-/m0/s1 |
| InChIKey | GCFVUQWDSCGHSF-YUPRTTJUSA-N |
| XLogP | -0.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |