C6H10O4 — CID 68732339
(1R,2R,3S,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 68732339) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (1R,2R,3S,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1R,2R,3S,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 68732339 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (1R,2R,3S,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | O[C@@H]1[C@@H](O)C[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C6H10O4/c7-3-1-5-9-2-4(10-5)6(3)8/h3-8H,1-2H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | KBSZGCLBGUKOON-SLPGGIOYSA-N |
| XLogP | -1.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |