C6H11F2NO — CID 72698931
2,6-bis(fluoromethyl)morpholine (PubChem CID 72698931) has the molecular formula C6H11F2NO and a molecular weight of 151.16 g/mol. Its IUPAC name is 2,6-bis(fluoromethyl)morpholine.
| Compound Name | 2,6-bis(fluoromethyl)morpholine |
|---|---|
| PubChem CID | 72698931 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 2,6-bis(fluoromethyl)morpholine |
| SMILES | FCC1CNCC(CF)O1 |
| InChI | InChI=1S/C6H11F2NO/c7-1-5-3-9-4-6(2-8)10-5/h5-6,9H,1-4H2 |
| InChIKey | LWWWYQKBWBKQMP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |