C20H24N6O3 — CID 51030053
tert-butyl 4-[5-[(3-cyano-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 51030053) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is tert-butyl 4-[5-[(3-cyano-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(3-cyano-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 51030053 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | tert-butyl 4-[5-[(3-cyano-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncc(OCc3ccncc3C#N)cn2)CC1 |
| InChI | InChI=1S/C20H24N6O3/c1-20(2,3)29-19(27)26-8-6-25(7-9-26)18-23-12-17(13-24-18)28-14-15-4-5-22-11-16(15)10-21/h4-5,11-13H,6-9,14H2,1-3H3 |
| InChIKey | RHLKIVUEHCVGSH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 104.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |