C20H27N5O3 — CID 51030811
tert-butyl 4-[5-[(3-methyl-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 51030811) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is tert-butyl 4-[5-[(3-methyl-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(3-methyl-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 51030811 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | tert-butyl 4-[5-[(3-methyl-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | Cc1cnccc1COc1cnc(N2CCN(C(=O)OC(C)(C)C)CC2)nc1 |
| InChI | InChI=1S/C20H27N5O3/c1-15-11-21-6-5-16(15)14-27-17-12-22-18(23-13-17)24-7-9-25(10-8-24)19(26)28-20(2,3)4/h5-6,11-13H,7-10,14H2,1-4H3 |
| InChIKey | JXIQMANEVJFITM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |