C26H20IN3O2 — CID 51030518
7-[4-(1-aminocyclobutyl)phenyl]-3-iodo-8-phenyl-2H-pyrano[3,2-g]indazol-6-one (PubChem CID 51030518) has the molecular formula C26H20IN3O2 and a molecular weight of 533.37 g/mol. Its IUPAC name is 7-[4-(1-aminocyclobutyl)phenyl]-3-iodo-8-phenyl-2H-pyrano[3,2-g]indazol-6-one.
| Compound Name | 7-[4-(1-aminocyclobutyl)phenyl]-3-iodo-8-phenyl-2H-pyrano[3,2-g]indazol-6-one |
|---|---|
| PubChem CID | 51030518 |
| Molecular Formula | C26H20IN3O2 |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 533.06 |
| IUPAC Name | 7-[4-(1-aminocyclobutyl)phenyl]-3-iodo-8-phenyl-2H-pyrano[3,2-g]indazol-6-one |
| SMILES | NC1(c2ccc(-c3c(-c4ccccc4)oc4c(ccc5c(I)[nH]nc54)c3=O)cc2)CCC1 |
| InChI | InChI=1S/C26H20IN3O2/c27-25-18-11-12-19-22(31)20(15-7-9-17(10-8-15)26(28)13-4-14-26)23(16-5-2-1-3-6-16)32-24(19)21(18)29-30-25/h1-3,5-12H,4,13-14,28H2,(H,29,30) |
| InChIKey | QETFPWUQPLHAIX-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|